C36H66N2O2 — CID 155176787
4-[(10S,13R,17S)-3-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dipentylbutanamide (PubChem CID 155176787) has the molecular formula C36H66N2O2 and a molecular weight of 558.94 g/mol. Its IUPAC name is 4-[(10S,13R,17S)-3-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dipentylbutanamide.
| Compound Name | 4-[(10S,13R,17S)-3-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dipentylbutanamide |
|---|---|
| PubChem CID | 155176787 |
| Molecular Formula | C36H66N2O2 |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.51 |
| IUPAC Name | 4-[(10S,13R,17S)-3-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dipentylbutanamide |
| SMILES | CCCCCN(CCCCC)C(=O)CCC[C@H]1CCC2C3CCC4CC(OCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H66N2O2/c1-5-7-9-24-38(25-10-8-6-2)34(39)14-11-13-28-16-18-32-31-17-15-29-27-30(40-26-12-23-37)19-21-36(29,4)33(31)20-22-35(28,32)3/h28-33H,5-27,37H2,1-4H3/t28-,29?,30?,31?,32?,33?,35+,36-/m0/s1 |
| InChIKey | OUOXZNFMWMNJJI-IVVVBKTRSA-N |
| XLogP | 8.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|