C38H70N2O2 — CID 101142550
(4R)-N-(7-aminoheptyl)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-heptoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide (PubChem CID 101142550) has the molecular formula C38H70N2O2 and a molecular weight of 586.99 g/mol. Its IUPAC name is (4R)-N-(7-aminoheptyl)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-heptoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide.
| Compound Name | (4R)-N-(7-aminoheptyl)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-heptoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
|---|---|
| PubChem CID | 101142550 |
| Molecular Formula | C38H70N2O2 |
| Molecular Weight | 586.99 g/mol |
| Exact Mass | 586.54 |
| IUPAC Name | (4R)-N-(7-aminoheptyl)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-heptoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
| SMILES | CCCCCCCO[C@@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCC(=O)NCCCCCCCN)CC[C@@H]32)C1 |
| InChI | InChI=1S/C38H70N2O2/c1-5-6-7-11-14-27-42-31-21-23-37(3)30(28-31)16-17-32-34-19-18-33(38(34,4)24-22-35(32)37)29(2)15-20-36(41)40-26-13-10-8-9-12-25-39/h29-35H,5-28,39H2,1-4H3,(H,40,41)/t29-,30-,31-,32+,33-,34+,35+,37+,38-/m1/s1 |
| InChIKey | YIEQAKZVTACIND-TXFGACRJSA-N |
| XLogP | 9.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.99 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|