C41H78N4O4 — CID 122645809
N-octyl-4-[(3R,7R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide (PubChem CID 122645809) has the molecular formula C41H78N4O4 and a molecular weight of 691.10 g/mol. Its IUPAC name is N-octyl-4-[(3R,7R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide.
| Compound Name | N-octyl-4-[(3R,7R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
|---|---|
| PubChem CID | 122645809 |
| Molecular Formula | C41H78N4O4 |
| Molecular Weight | 691.10 g/mol |
| Exact Mass | 690.60 |
| IUPAC Name | N-octyl-4-[(3R,7R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
| SMILES | CCCCCCCCNC(=O)CCC(C)[C@H]1CC[C@H]2C3C(OCCCN)CC4C[C@H](OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)C12C |
| InChI | InChI=1S/C41H78N4O4/c1-5-6-7-8-9-10-23-45-38(46)17-14-30(2)33-15-16-34-39-35(29-37(41(33,34)4)49-26-13-22-44)40(3)19-18-32(47-24-11-20-42)27-31(40)28-36(39)48-25-12-21-43/h30-37,39H,5-29,42-44H2,1-4H3,(H,45,46)/t30?,31?,32-,33-,34+,35+,36?,37+,39?,40+,41?/m1/s1 |
| InChIKey | RNVCLYVUSGTLAA-SHGMTAKFSA-N |
| XLogP | 6.96 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.10 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|