C34H64N4O4 — CID 139372820
N-methyl-4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide (PubChem CID 139372820) has the molecular formula C34H64N4O4 and a molecular weight of 592.91 g/mol. Its IUPAC name is N-methyl-4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide.
| Compound Name | N-methyl-4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
|---|---|
| PubChem CID | 139372820 |
| Molecular Formula | C34H64N4O4 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.49 |
| IUPAC Name | N-methyl-4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
| SMILES | CNC(=O)CCC(C)C1CC[C@H]2C3C(OCCCN)CC4C[C@H](OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)[C@]12C |
| InChI | InChI=1S/C34H64N4O4/c1-23(8-11-31(39)38-4)26-9-10-27-32-28(22-30(34(26,27)3)42-19-7-16-37)33(2)13-12-25(40-17-5-14-35)20-24(33)21-29(32)41-18-6-15-36/h23-30,32H,5-22,35-37H2,1-4H3,(H,38,39)/t23?,24?,25-,26?,27+,28+,29?,30+,32?,33+,34-/m1/s1 |
| InChIKey | AZUGKIZYPZCWJQ-DFQMXVGDSA-N |
| XLogP | 4.23 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|