C31H59N3O4 — CID 90448127
(2S)-2-[(3R,7R,9S,10S,12S,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol (PubChem CID 90448127) has the molecular formula C31H59N3O4 and a molecular weight of 537.83 g/mol. Its IUPAC name is (2S)-2-[(3R,7R,9S,10S,12S,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol.
| Compound Name | (2S)-2-[(3R,7R,9S,10S,12S,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol |
|---|---|
| PubChem CID | 90448127 |
| Molecular Formula | C31H59N3O4 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.45 |
| IUPAC Name | (2S)-2-[(3R,7R,9S,10S,12S,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol |
| SMILES | C[C@H](CO)C1CC[C@H]2C3C(OCCCN)CC4C[C@H](OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)C12C |
| InChI | InChI=1S/C31H59N3O4/c1-21(20-35)24-7-8-25-29-26(19-28(31(24,25)3)38-16-6-13-34)30(2)10-9-23(36-14-4-11-32)17-22(30)18-27(29)37-15-5-12-33/h21-29,35H,4-20,32-34H2,1-3H3/t21-,22?,23-,24?,25+,26+,27?,28+,29?,30+,31?/m1/s1 |
| InChIKey | GRKRFAWNIZOMIZ-VAUAEYGFSA-N |
| XLogP | 3.70 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|