C36H70N4O4 — CID 166858349
3-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]propan-1-amine (PubChem CID 166858349) has the molecular formula C36H70N4O4 and a molecular weight of 622.98 g/mol. Its IUPAC name is 3-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]propan-1-amine.
| Compound Name | 3-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]propan-1-amine |
|---|---|
| PubChem CID | 166858349 |
| Molecular Formula | C36H70N4O4 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.54 |
| IUPAC Name | 3-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]propan-1-amine |
| SMILES | CC(CCCOCCCN)C1CC[C@H]2C3C(OCCCN)CC4C[C@H](OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)[C@]12C |
| InChI | InChI=1S/C36H70N4O4/c1-26(9-4-18-41-19-5-14-37)29-10-11-30-34-31(25-33(36(29,30)3)44-22-8-17-40)35(2)13-12-28(42-20-6-15-38)23-27(35)24-32(34)43-21-7-16-39/h26-34H,4-25,37-40H2,1-3H3/t26?,27?,28-,29?,30+,31+,32?,33+,34?,35+,36-/m1/s1 |
| InChIKey | NRARCDPRCCLIMQ-IDVRRRKUSA-N |
| XLogP | 4.85 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|