C36H69N3O4 — CID 166858292
4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(4-aminobutoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol (PubChem CID 166858292) has the molecular formula C36H69N3O4 and a molecular weight of 607.97 g/mol. Its IUPAC name is 4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(4-aminobutoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol.
| Compound Name | 4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(4-aminobutoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol |
|---|---|
| PubChem CID | 166858292 |
| Molecular Formula | C36H69N3O4 |
| Molecular Weight | 607.97 g/mol |
| Exact Mass | 607.53 |
| IUPAC Name | 4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(4-aminobutoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol |
| SMILES | CC(CCCO)C1CC[C@H]2C3C(OCCCCN)CC4C[C@H](OCCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCCN)[C@]12C |
| InChI | InChI=1S/C36H69N3O4/c1-26(11-10-19-40)29-12-13-30-34-31(25-33(36(29,30)3)43-22-9-6-18-39)35(2)15-14-28(41-20-7-4-16-37)23-27(35)24-32(34)42-21-8-5-17-38/h26-34,40H,4-25,37-39H2,1-3H3/t26?,27?,28-,29?,30+,31+,32?,33+,34?,35+,36-/m1/s1 |
| InChIKey | BUSPEHKWYJGUGQ-IDVRRRKUSA-N |
| XLogP | 5.65 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.97 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|