C36H70N4O3 — CID 126706741
(4R)-N-ethyl-N-methyl-4-[(3R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-amine (PubChem CID 126706741) has the molecular formula C36H70N4O3 and a molecular weight of 606.98 g/mol. Its IUPAC name is (4R)-N-ethyl-N-methyl-4-[(3R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-amine.
| Compound Name | (4R)-N-ethyl-N-methyl-4-[(3R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-amine |
|---|---|
| PubChem CID | 126706741 |
| Molecular Formula | C36H70N4O3 |
| Molecular Weight | 606.98 g/mol |
| Exact Mass | 606.54 |
| IUPAC Name | (4R)-N-ethyl-N-methyl-4-[(3R,9S,10S,12S,14S,17R)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-amine |
| SMILES | CCN(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3C(OCCCN)CC4C[C@H](OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)C12C |
| InChI | InChI=1S/C36H70N4O3/c1-6-40(5)19-7-11-26(2)29-12-13-30-34-31(25-33(36(29,30)4)43-22-10-18-39)35(3)15-14-28(41-20-8-16-37)23-27(35)24-32(34)42-21-9-17-38/h26-34H,6-25,37-39H2,1-5H3/t26-,27?,28-,29-,30+,31+,32?,33+,34?,35+,36?/m1/s1 |
| InChIKey | BOGAEGHZAWIDFU-IFFLYQINSA-N |
| XLogP | 5.44 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.98 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|