C43H82N4O4 — CID 126723221
N,N-dipentyl-4-[(7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide (PubChem CID 126723221) has the molecular formula C43H82N4O4 and a molecular weight of 719.15 g/mol. Its IUPAC name is N,N-dipentyl-4-[(7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide.
| Compound Name | N,N-dipentyl-4-[(7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
|---|---|
| PubChem CID | 126723221 |
| Molecular Formula | C43H82N4O4 |
| Molecular Weight | 719.15 g/mol |
| Exact Mass | 718.63 |
| IUPAC Name | N,N-dipentyl-4-[(7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
| SMILES | CCCCCN(CCCCC)C(=O)CCC(C)C1CC[C@H]2C3C(OCCCN)CC4CC(OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)[C@]12C |
| InChI | InChI=1S/C43H82N4O4/c1-6-8-10-24-47(25-11-9-7-2)40(48)18-15-32(3)35-16-17-36-41-37(31-39(43(35,36)5)51-28-14-23-46)42(4)20-19-34(49-26-12-21-44)29-33(42)30-38(41)50-27-13-22-45/h32-39,41H,6-31,44-46H2,1-5H3/t32?,33?,34?,35?,36-,37-,38?,39-,41?,42-,43+/m0/s1 |
| InChIKey | OWKWVWXAOPDBCE-MJJCZAQBSA-N |
| XLogP | 7.69 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.15 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|