C24H43NO2 — CID 77430871
3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 77430871) has the molecular formula C24H43NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 77430871 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | 3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CN(C)CCCOC1CCC2(C)C(CCC3C4CCC(O)C4(C)CCC32)C1 |
| InChI | InChI=1S/C24H43NO2/c1-23-12-10-18(27-15-5-14-25(3)4)16-17(23)6-7-19-20-8-9-22(26)24(20,2)13-11-21(19)23/h17-22,26H,5-16H2,1-4H3 |
| InChIKey | HWWDCYRIOOIDJF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|