C24H43NO3 — CID 15838424
(3S,5S,6R,8R,9S,10R,13S,14S,17S)-3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol (PubChem CID 15838424) has the molecular formula C24H43NO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is (3S,5S,6R,8R,9S,10R,13S,14S,17S)-3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol.
| Compound Name | (3S,5S,6R,8R,9S,10R,13S,14S,17S)-3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol |
|---|---|
| PubChem CID | 15838424 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | (3S,5S,6R,8R,9S,10R,13S,14S,17S)-3-[3-(dimethylamino)propoxy]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol |
| SMILES | CN(C)CCCO[C@H]1CC[C@@]2(C)[C@H](C1)[C@H](O)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C24H43NO3/c1-23-10-8-16(28-13-5-12-25(3)4)14-20(23)21(26)15-17-18-6-7-22(27)24(18,2)11-9-19(17)23/h16-22,26-27H,5-15H2,1-4H3/t16-,17-,18-,19-,20+,21+,22-,23+,24-/m0/s1 |
| InChIKey | LKELZCBINVAELO-OPTXLBARSA-N |
| XLogP | 3.70 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|