C21H36O3 — CID 68730642
(3S,6S,8R,9S,10R,13S,14S,17S)-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,17-triol (PubChem CID 68730642) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (3S,6S,8R,9S,10R,13S,14S,17S)-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,17-triol.
| Compound Name | (3S,6S,8R,9S,10R,13S,14S,17S)-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,17-triol |
|---|---|
| PubChem CID | 68730642 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (3S,6S,8R,9S,10R,13S,14S,17S)-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,17-triol |
| SMILES | CC1(C)C2[C@@H](O)C[C@H]3[C@@H]4CC[C@H](O)[C@@]4(C)CC[C@@H]3[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C21H36O3/c1-19(2)16(23)8-10-21(4)14-7-9-20(3)13(5-6-17(20)24)12(14)11-15(22)18(19)21/h12-18,22-24H,5-11H2,1-4H3/t12-,13-,14-,15-,16-,17-,18?,20-,21+/m0/s1 |
| InChIKey | VIGJAAUOMFVSEH-OOBDCHBCSA-N |
| XLogP | 3.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |