C19H31FO3 — CID 69464288
(3S,8R,9S,10R,13S,14S,17S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,17-triol (PubChem CID 69464288) has the molecular formula C19H31FO3 and a molecular weight of 326.45 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,17-triol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,17-triol |
|---|---|
| PubChem CID | 69464288 |
| Molecular Formula | C19H31FO3 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,17-triol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(O)C4C(F)[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H31FO3/c1-18-7-5-12-10(11(18)3-4-15(18)23)9-14(22)16-17(20)13(21)6-8-19(12,16)2/h10-17,21-23H,3-9H2,1-2H3/t10-,11-,12-,13-,14?,15-,16?,17?,18-,19+/m0/s1 |
| InChIKey | GFDZDQUXGHUYQP-QTDXYYHJSA-N |
| XLogP | 2.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |