C19H32O5 — CID 157107707
(3S,6R,10R,13S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,4,6,7,17-pentol (PubChem CID 157107707) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (3S,6R,10R,13S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,4,6,7,17-pentol.
| Compound Name | (3S,6R,10R,13S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,4,6,7,17-pentol |
|---|---|
| PubChem CID | 157107707 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3S,6R,10R,13S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,4,6,7,17-pentol |
| SMILES | C[C@]12CC[C@H](O)C(O)C1[C@@H](O)C(O)C1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C19H32O5/c1-18-7-5-10-13(9(18)3-4-12(18)21)16(23)17(24)14-15(22)11(20)6-8-19(10,14)2/h9-17,20-24H,3-8H2,1-2H3/t9?,10?,11-,12-,13?,14?,15?,16?,17+,18-,19+/m0/s1 |
| InChIKey | BELSMDXICRFHFJ-VNXDRTCXSA-N |
| XLogP | 0.66 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |