C21H31FO3 — CID 91419013
(8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol (PubChem CID 91419013) has the molecular formula C21H31FO3 and a molecular weight of 350.47 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol.
| Compound Name | (8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol |
|---|---|
| PubChem CID | 91419013 |
| Molecular Formula | C21H31FO3 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-triol |
| SMILES | C[C@]12CCC(O)C(C#CF)C1CC(O)[C@@H]1[C@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C21H31FO3/c1-20-9-6-16(23)12(7-10-22)15(20)11-17(24)19-13-3-4-18(25)21(13,2)8-5-14(19)20/h12-19,23-25H,3-6,8-9,11H2,1-2H3/t12?,13-,14+,15?,16?,17?,18?,19-,20+,21-/m0/s1 |
| InChIKey | VVADXNVDQSFAQK-IPNJNSTGSA-N |
| XLogP | 2.88 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|