About 6-methyltricyclo[4.4.0.02,7]decan-3-ol
6-methyltricyclo[4.4.0.02,7]decan-3-ol (PubChem CID 121218890) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 6-methyltricyclo[4.4.0.02,7]decan-3-ol.
Molecular Properties
| Compound Name | 6-methyltricyclo[4.4.0.02,7]decan-3-ol |
| PubChem CID | 121218890 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 6-methyltricyclo[4.4.0.02,7]decan-3-ol |
| SMILES | CC12CCC(O)C3C1CCCC32 |
| InChI | InChI=1S/C11H18O/c1-11-6-5-9(12)10-7(11)3-2-4-8(10)11/h7-10,12H,2-6H2,1H3 |
| InChIKey | GKWHGNYOHCWDOO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyltricyclo[4.4.0.02,7]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyltricyclo[4.4.0.02,7]decan-3-ol?
The IUPAC name of 6-methyltricyclo[4.4.0.02,7]decan-3-ol (CID 121218890) is 6-methyltricyclo[4.4.0.02,7]decan-3-ol.
What is the SMILES notation for 6-methyltricyclo[4.4.0.02,7]decan-3-ol?
The canonical SMILES for 6-methyltricyclo[4.4.0.02,7]decan-3-ol is CC12CCC(O)C3C1CCCC32.
What is the InChIKey of 6-methyltricyclo[4.4.0.02,7]decan-3-ol?
The InChIKey is GKWHGNYOHCWDOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-11-6-5-9(12)10-7(11)3-2-4-8(10)11/h7-10,12H,2-6H2,1H3.
What are the key properties of 6-methyltricyclo[4.4.0.02,7]decan-3-ol?
6-methyltricyclo[4.4.0.02,7]decan-3-ol has a molecular weight of 166.26 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyltricyclo[4.4.0.02,7]decan-3-ol is sourced from PubChem (CID 121218890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).