C13H23IO — CID 95162759
(1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-3a-methyl-1,2,3,4,5,6,7,7a-octahydroinden-4-ol (PubChem CID 95162759) has the molecular formula C13H23IO and a molecular weight of 322.23 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-3a-methyl-1,2,3,4,5,6,7,7a-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-3a-methyl-1,2,3,4,5,6,7,7a-octahydroinden-4-ol |
|---|---|
| PubChem CID | 95162759 |
| Molecular Formula | C13H23IO |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-3a-methyl-1,2,3,4,5,6,7,7a-octahydroinden-4-ol |
| SMILES | C[C@H](CI)[C@@H]1CC[C@]2(C)[C@@H]1CCC[C@@H]2O |
| InChI | InChI=1S/C13H23IO/c1-9(8-14)10-6-7-13(2)11(10)4-3-5-12(13)15/h9-12,15H,3-8H2,1-2H3/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | MFCCXDMJEVDIKD-RXGFPQBGSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|