C21H32O4 — CID 87752129
(3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,4,7,17-tetrol (PubChem CID 87752129) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,4,7,17-tetrol.
| Compound Name | (3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,4,7,17-tetrol |
|---|---|
| PubChem CID | 87752129 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,4,7,17-tetrol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3[C@@H](O)CC4[C@@H](O)[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H32O4/c1-4-21(25)10-6-13-17-12(5-9-20(13,21)3)19(2)8-7-15(22)18(24)14(19)11-16(17)23/h1,12-18,22-25H,5-11H2,2-3H3/t12-,13-,14?,15+,16-,17+,18+,19+,20-,21-/m0/s1 |
| InChIKey | AOIJVPKCRREAOE-FDJNCOQRSA-N |
| XLogP | 1.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|