C21H30O4 — CID 91426075
(8R,9R,10R,13S,14S)-17-ethynyl-3,7,17-trihydroxy-10,13-dimethyl-2,3,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-4-one (PubChem CID 91426075) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-ethynyl-3,7,17-trihydroxy-10,13-dimethyl-2,3,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-4-one.
| Compound Name | (8R,9R,10R,13S,14S)-17-ethynyl-3,7,17-trihydroxy-10,13-dimethyl-2,3,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-4-one |
|---|---|
| PubChem CID | 91426075 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-ethynyl-3,7,17-trihydroxy-10,13-dimethyl-2,3,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-4-one |
| SMILES | C#CC1(O)CC[C@H]2[C@@H]3C(O)CC4C(=O)C(O)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H30O4/c1-4-21(25)10-6-13-17-12(5-9-20(13,21)3)19(2)8-7-15(22)18(24)14(19)11-16(17)23/h1,12-17,22-23,25H,5-11H2,2-3H3/t12-,13+,14?,15?,16?,17-,19-,20+,21?/m1/s1 |
| InChIKey | HNSMHDMJFHIYRS-SLCMFLEISA-N |
| XLogP | 1.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|