C23H31FO4 — CID 87753000
[(3S,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-7,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 87753000) has the molecular formula C23H31FO4 and a molecular weight of 390.50 g/mol. Its IUPAC name is [(3S,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-7,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-7,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 87753000 |
| Molecular Formula | C23H31FO4 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(3S,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-7,17-dihydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3[C@@H](O)CC4=C(F)[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H31FO4/c1-5-23(27)11-7-15-19-14(6-10-22(15,23)4)21(3)9-8-18(28-13(2)25)20(24)16(21)12-17(19)26/h1,14-15,17-19,26-27H,6-12H2,2-4H3/t14-,15-,17-,18-,19+,21+,22-,23-/m0/s1 |
| InChIKey | CUFHZFZYKYCOIL-WBEMYCJWSA-N |
| XLogP | 3.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|