C23H33FO4 — CID 87751914
[(3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 87751914) has the molecular formula C23H33FO4 and a molecular weight of 392.51 g/mol. Its IUPAC name is [(3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 87751914 |
| Molecular Formula | C23H33FO4 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [(3R,4R,7S,8R,9S,10R,13S,14S,17R)-17-ethynyl-4-fluoro-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3[C@@H](OC(C)=O)CC4[C@@H](F)[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H33FO4/c1-5-23(27)11-7-15-19-14(6-10-22(15,23)4)21(3)9-8-17(26)20(24)16(21)12-18(19)28-13(2)25/h1,14-20,26-27H,6-12H2,2-4H3/t14-,15-,16?,17+,18-,19+,20+,21+,22-,23-/m0/s1 |
| InChIKey | ZOFPYXFYXCFESR-HAXUPKAPSA-N |
| XLogP | 3.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|