C27H38O5 — CID 118691093
(6,7,17-trihydroxy-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 118691093) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is (6,7,17-trihydroxy-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (6,7,17-trihydroxy-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 118691093 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (6,7,17-trihydroxy-10,13-dimethyl-17-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(C1)C(O)C(O)C1C2CCC2(C)C1CCC2(O)c1ccccc1 |
| InChI | InChI=1S/C27H38O5/c1-16(28)32-18-9-12-25(2)19-10-13-26(3)20(22(19)24(30)23(29)21(25)15-18)11-14-27(26,31)17-7-5-4-6-8-17/h4-8,18-24,29-31H,9-15H2,1-3H3 |
| InChIKey | AYUSWIVYPHVWMJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |