C27H37BrO4 — CID 99572884
[(3R,5S,6R,8S,9S,10R,13S,14S,17S)-6-bromo-5-hydroxy-10,13-dimethyl-17-phenoxy-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 99572884) has the molecular formula C27H37BrO4 and a molecular weight of 505.49 g/mol. Its IUPAC name is [(3R,5S,6R,8S,9S,10R,13S,14S,17S)-6-bromo-5-hydroxy-10,13-dimethyl-17-phenoxy-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,6R,8S,9S,10R,13S,14S,17S)-6-bromo-5-hydroxy-10,13-dimethyl-17-phenoxy-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 99572884 |
| Molecular Formula | C27H37BrO4 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [(3R,5S,6R,8S,9S,10R,13S,14S,17S)-6-bromo-5-hydroxy-10,13-dimethyl-17-phenoxy-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](Oc5ccccc5)CC[C@H]4[C@@H]3C[C@@H](Br)[C@]2(O)C1 |
| InChI | InChI=1S/C27H37BrO4/c1-17(29)31-19-11-14-26(3)22-12-13-25(2)21(20(22)15-23(28)27(26,30)16-19)9-10-24(25)32-18-7-5-4-6-8-18/h4-8,19-24,30H,9-16H2,1-3H3/t19-,20+,21+,22+,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | ITFRLFYVHXDNCR-ULFSDKRUSA-N |
| XLogP | 5.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|