C25H39BrO5 — CID 57209343
[(8R,9R,10R,13S,14S)-17-acetyloxy-5-(2-bromoethyl)-6-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 57209343) has the molecular formula C25H39BrO5 and a molecular weight of 499.49 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-17-acetyloxy-5-(2-bromoethyl)-6-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9R,10R,13S,14S)-17-acetyloxy-5-(2-bromoethyl)-6-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 57209343 |
| Molecular Formula | C25H39BrO5 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-17-acetyloxy-5-(2-bromoethyl)-6-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@]2(C)[C@@H]3CC[C@]4(C)C(OC(C)=O)CC[C@H]4[C@@H]3CC(O)C2(CCBr)C1 |
| InChI | InChI=1S/C25H39BrO5/c1-15(27)30-17-7-10-24(4)20-8-9-23(3)19(5-6-22(23)31-16(2)28)18(20)13-21(29)25(24,14-17)11-12-26/h17-22,29H,5-14H2,1-4H3/t17?,18-,19-,20+,21?,22?,23-,24+,25?/m0/s1 |
| InChIKey | WDQSJSZKAQTSPA-QFWAPYEGSA-N |
| XLogP | 5.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|