C26H34O5 — CID 10202727
[(3S,10R,13S)-6,7-dihydroxy-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 10202727) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is [(3S,10R,13S)-6,7-dihydroxy-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,10R,13S)-6,7-dihydroxy-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 10202727 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [(3S,10R,13S)-6,7-dihydroxy-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CC[C@H](OC(=O)c3ccccc3)CC1C(O)C(O)C1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C26H34O5/c1-25-12-10-16(31-24(30)15-6-4-3-5-7-15)14-19(25)22(28)23(29)21-17-8-9-20(27)26(17,2)13-11-18(21)25/h3-7,16-19,21-23,28-29H,8-14H2,1-2H3/t16-,17?,18?,19?,21?,22?,23?,25+,26-/m0/s1 |
| InChIKey | ARPUZXLTVFTPIM-TZPRFBENSA-N |
| XLogP | 3.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |