C26H33IO3 — CID 40872367
[(3R,5S,8R,9R,10S,13S,14R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate (PubChem CID 40872367) has the molecular formula C26H33IO3 and a molecular weight of 520.45 g/mol. Its IUPAC name is [(3R,5S,8R,9R,10S,13S,14R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate.
| Compound Name | [(3R,5S,8R,9R,10S,13S,14R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate |
|---|---|
| PubChem CID | 40872367 |
| Molecular Formula | C26H33IO3 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | [(3R,5S,8R,9R,10S,13S,14R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate |
| SMILES | C[C@]12CC[C@@H](OC(=O)c3cccc(I)c3)C[C@@H]1CC[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@H]12 |
| InChI | InChI=1S/C26H33IO3/c1-25-12-10-19(30-24(29)16-4-3-5-18(27)14-16)15-17(25)6-7-20-21-8-9-23(28)26(21,2)13-11-22(20)25/h3-5,14,17,19-22H,6-13,15H2,1-2H3/t17-,19+,20-,21+,22+,25-,26-/m0/s1 |
| InChIKey | DNENTRDNKLNGCK-ABFLOZPJSA-N |
| XLogP | 6.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|