C22H35NO3 — CID 67042774
(10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-aminopropanoate (PubChem CID 67042774) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-aminopropanoate.
| Compound Name | (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-aminopropanoate |
|---|---|
| PubChem CID | 67042774 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-aminopropanoate |
| SMILES | CC12CCC3C(CCC4CC(OC(=O)CCN)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C22H35NO3/c1-21-10-7-15(26-20(25)9-12-23)13-14(21)3-4-16-17-5-6-19(24)22(17,2)11-8-18(16)21/h14-18H,3-13,23H2,1-2H3 |
| InChIKey | YEOLKHLMADXYOL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |