C27H36O5S — CID 167363213
[(3S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(benzenesulfonyl)acetate (PubChem CID 167363213) has the molecular formula C27H36O5S and a molecular weight of 472.65 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(benzenesulfonyl)acetate.
| Compound Name | [(3S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(benzenesulfonyl)acetate |
|---|---|
| PubChem CID | 167363213 |
| Molecular Formula | C27H36O5S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(3S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(benzenesulfonyl)acetate |
| SMILES | C[C@]12CC[C@H](OC(=O)CS(=O)(=O)c3ccccc3)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C27H36O5S/c1-26-14-12-19(32-25(29)17-33(30,31)20-6-4-3-5-7-20)16-18(26)8-9-21-22-10-11-24(28)27(22,2)15-13-23(21)26/h3-7,18-19,21-23H,8-17H2,1-2H3/t18?,19-,21-,22-,23-,26-,27-/m0/s1 |
| InChIKey | MRKYSKHCARSNCI-FANIKVJTSA-N |
| XLogP | 4.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |