C27H40O2Si — CID 631423
3-[dimethyl(phenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 631423) has the molecular formula C27H40O2Si and a molecular weight of 424.70 g/mol. Its IUPAC name is 3-[dimethyl(phenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-[dimethyl(phenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 631423 |
| Molecular Formula | C27H40O2Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 3-[dimethyl(phenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C(CCC4CC(O[Si](C)(C)c5ccccc5)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C27H40O2Si/c1-26-16-14-20(29-30(3,4)21-8-6-5-7-9-21)18-19(26)10-11-22-23-12-13-25(28)27(23,2)17-15-24(22)26/h5-9,19-20,22-24H,10-18H2,1-4H3 |
| InChIKey | BYPVNQZWFGJFLG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|