C22H32N2O2 — CID 175452317
(3S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-(1H-pyrazol-5-yloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 175452317) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (3S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-(1H-pyrazol-5-yloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-(1H-pyrazol-5-yloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 175452317 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (3S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-(1H-pyrazol-5-yloxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H](Oc3ccn[nH]3)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H32N2O2/c1-21-10-7-15(26-20-9-12-23-24-20)13-14(21)3-4-16-17-5-6-19(25)22(17,2)11-8-18(16)21/h9,12,14-18H,3-8,10-11,13H2,1-2H3,(H,23,24)/t14?,15-,16-,17-,18-,21-,22-/m0/s1 |
| InChIKey | OOPJJACKSCKPJA-VOILPGBBSA-N |
| XLogP | 4.77 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |