C26H36O2 — CID 2754169
(3S,5S,10S,13S)-10,13-dimethyl-3-phenylmethoxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 2754169) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is (3S,5S,10S,13S)-10,13-dimethyl-3-phenylmethoxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,5S,10S,13S)-10,13-dimethyl-3-phenylmethoxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 2754169 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (3S,5S,10S,13S)-10,13-dimethyl-3-phenylmethoxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3C(CC[C@H]4C[C@@H](OCc5ccccc5)CC[C@]34C)C1CCC2=O |
| InChI | InChI=1S/C26H36O2/c1-25-14-12-20(28-17-18-6-4-3-5-7-18)16-19(25)8-9-21-22-10-11-24(27)26(22,2)15-13-23(21)25/h3-7,19-23H,8-17H2,1-2H3/t19-,20-,21?,22?,23?,25-,26-/m0/s1 |
| InChIKey | UNVMFWARNISDCV-HAMMEEKCSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |