C24H32O4 — CID 3295158
(10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) furan-2-carboxylate (PubChem CID 3295158) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) furan-2-carboxylate.
| Compound Name | (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) furan-2-carboxylate |
|---|---|
| PubChem CID | 3295158 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl) furan-2-carboxylate |
| SMILES | CC12CCC3C(CCC4CC(OC(=O)c5ccco5)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C24H32O4/c1-23-11-9-16(28-22(26)20-4-3-13-27-20)14-15(23)5-6-17-18-7-8-21(25)24(18,2)12-10-19(17)23/h3-4,13,15-19H,5-12,14H2,1-2H3 |
| InChIKey | KYSVLWJXZYLYCR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |