C40H48O4 — CID 58710986
(3R,6R,7R,10R,13S)-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 58710986) has the molecular formula C40H48O4 and a molecular weight of 592.82 g/mol. Its IUPAC name is (3R,6R,7R,10R,13S)-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,6R,7R,10R,13S)-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 58710986 |
| Molecular Formula | C40H48O4 |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | (3R,6R,7R,10R,13S)-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H](OCc3ccccc3)CC1[C@@H](OCc1ccccc1)C(OCc1ccccc1)C1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C40H48O4/c1-39-22-20-31(42-25-28-12-6-3-7-13-28)24-34(39)37(43-26-29-14-8-4-9-15-29)38(44-27-30-16-10-5-11-17-30)36-32-18-19-35(41)40(32,2)23-21-33(36)39/h3-17,31-34,36-38H,18-27H2,1-2H3/t31-,32?,33?,34?,36?,37-,38?,39-,40+/m1/s1 |
| InChIKey | RUBJFTABDBRACQ-WZJWLRBGSA-N |
| XLogP | 8.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |