C42H52O3 — CID 58711008
(3R,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 58711008) has the molecular formula C42H52O3 and a molecular weight of 604.88 g/mol. Its IUPAC name is (3R,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3R,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58711008 |
| Molecular Formula | C42H52O3 |
| Molecular Weight | 604.88 g/mol |
| Exact Mass | 604.39 |
| IUPAC Name | (3R,6R,7R,10R,13S,17Z)-17-ethylidene-10,13-dimethyl-3,6,7-tris(phenylmethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C/C=C1/CCC2C3C(OCc4ccccc4)[C@H](OCc4ccccc4)C4C[C@H](OCc5ccccc5)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C42H52O3/c1-4-33-20-21-35-38-36(23-25-41(33,35)2)42(3)24-22-34(43-27-30-14-8-5-9-15-30)26-37(42)39(44-28-31-16-10-6-11-17-31)40(38)45-29-32-18-12-7-13-19-32/h4-19,34-40H,20-29H2,1-3H3/b33-4-/t34-,35?,36?,37?,38?,39-,40?,41-,42-/m1/s1 |
| InChIKey | CPAYZZGQEADPSU-MMOQPDSSSA-N |
| XLogP | 9.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.88 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|