C28H40O — CID 91367680
(9R,10S,13S)-17-ethylidene-10,13-dimethyl-9-phenylmethoxy-2,3,4,5,6,7,8,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 91367680) has the molecular formula C28H40O and a molecular weight of 392.63 g/mol. Its IUPAC name is (9R,10S,13S)-17-ethylidene-10,13-dimethyl-9-phenylmethoxy-2,3,4,5,6,7,8,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (9R,10S,13S)-17-ethylidene-10,13-dimethyl-9-phenylmethoxy-2,3,4,5,6,7,8,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 91367680 |
| Molecular Formula | C28H40O |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (9R,10S,13S)-17-ethylidene-10,13-dimethyl-9-phenylmethoxy-2,3,4,5,6,7,8,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC=C1CCC2C3CCC4CCCC[C@]4(C)[C@@]3(OCc3ccccc3)CC[C@]12C |
| InChI | InChI=1S/C28H40O/c1-4-22-13-15-24-25-16-14-23-12-8-9-17-27(23,3)28(25,19-18-26(22,24)2)29-20-21-10-6-5-7-11-21/h4-7,10-11,23-25H,8-9,12-20H2,1-3H3/t23?,24?,25?,26-,27+,28-/m1/s1 |
| InChIKey | DTWNLOZLWVAZEG-AIVSTUOQSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|