C17H26O2 — CID 131850860
(2R)-2-methyl-2-(3-phenylmethoxypropyl)cyclohexan-1-ol (PubChem CID 131850860) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (2R)-2-methyl-2-(3-phenylmethoxypropyl)cyclohexan-1-ol.
| Compound Name | (2R)-2-methyl-2-(3-phenylmethoxypropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 131850860 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (2R)-2-methyl-2-(3-phenylmethoxypropyl)cyclohexan-1-ol |
| SMILES | C[C@]1(CCCOCc2ccccc2)CCCCC1O |
| InChI | InChI=1S/C17H26O2/c1-17(11-6-5-10-16(17)18)12-7-13-19-14-15-8-3-2-4-9-15/h2-4,8-9,16,18H,5-7,10-14H2,1H3/t16?,17-/m1/s1 |
| InChIKey | HGJKXXDDEUGUSC-ZYMOGRSISA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|