C20H30O2 — CID 11162460
(1R,4aR,8R,8aR)-4a,8-dimethyl-8-(phenylmethoxymethyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-ol (PubChem CID 11162460) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,4aR,8R,8aR)-4a,8-dimethyl-8-(phenylmethoxymethyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-ol.
| Compound Name | (1R,4aR,8R,8aR)-4a,8-dimethyl-8-(phenylmethoxymethyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11162460 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,4aR,8R,8aR)-4a,8-dimethyl-8-(phenylmethoxymethyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-ol |
| SMILES | C[C@@]12CCC[C@@H](O)[C@H]1[C@](C)(COCc1ccccc1)CCC2 |
| InChI | InChI=1S/C20H30O2/c1-19-11-6-10-17(21)18(19)20(2,13-7-12-19)15-22-14-16-8-4-3-5-9-16/h3-5,8-9,17-18,21H,6-7,10-15H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | FXBPYSHZSHUBNW-ZRNYENFQSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |