C13H18O3 — CID 15450619
(4S)-4-methyl-4-(phenylmethoxymethyl)oxolan-2-ol (PubChem CID 15450619) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (4S)-4-methyl-4-(phenylmethoxymethyl)oxolan-2-ol.
| Compound Name | (4S)-4-methyl-4-(phenylmethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 15450619 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (4S)-4-methyl-4-(phenylmethoxymethyl)oxolan-2-ol |
| SMILES | C[C@]1(COCc2ccccc2)COC(O)C1 |
| InChI | InChI=1S/C13H18O3/c1-13(7-12(14)16-10-13)9-15-8-11-5-3-2-4-6-11/h2-6,12,14H,7-10H2,1H3/t12?,13-/m0/s1 |
| InChIKey | FQGHCXNXPJTVMU-ABLWVSNPSA-N |
| XLogP | 1.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |