C12H16O3S — CID 19350843
5-(phenylmethoxymethyl)-1,4-oxathian-2-ol (PubChem CID 19350843) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 5-(phenylmethoxymethyl)-1,4-oxathian-2-ol.
| Compound Name | 5-(phenylmethoxymethyl)-1,4-oxathian-2-ol |
|---|---|
| PubChem CID | 19350843 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 5-(phenylmethoxymethyl)-1,4-oxathian-2-ol |
| SMILES | OC1CSC(COCc2ccccc2)CO1 |
| InChI | InChI=1S/C12H16O3S/c13-12-9-16-11(8-15-12)7-14-6-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2 |
| InChIKey | MPDPFGUWSVPCDL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |