About oxiran-2-ylmethanol;phenylmethoxymethylbenzene
oxiran-2-ylmethanol;phenylmethoxymethylbenzene (PubChem CID 87861777) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is oxiran-2-ylmethanol;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | oxiran-2-ylmethanol;phenylmethoxymethylbenzene |
| PubChem CID | 87861777 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | oxiran-2-ylmethanol;phenylmethoxymethylbenzene |
| SMILES | OCC1CO1.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C3H6O2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;4-1-3-2-5-3/h1-10H,11-12H2;3-4H,1-2H2 |
| InChIKey | SAVCSBDNYRPDQU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethanol;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethanol;phenylmethoxymethylbenzene?
The IUPAC name of oxiran-2-ylmethanol;phenylmethoxymethylbenzene (CID 87861777) is oxiran-2-ylmethanol;phenylmethoxymethylbenzene.
What is the SMILES notation for oxiran-2-ylmethanol;phenylmethoxymethylbenzene?
The canonical SMILES for oxiran-2-ylmethanol;phenylmethoxymethylbenzene is OCC1CO1.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of oxiran-2-ylmethanol;phenylmethoxymethylbenzene?
The InChIKey is SAVCSBDNYRPDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C3H6O2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;4-1-3-2-5-3/h1-10H,11-12H2;3-4H,1-2H2.
What are the key properties of oxiran-2-ylmethanol;phenylmethoxymethylbenzene?
oxiran-2-ylmethanol;phenylmethoxymethylbenzene has a molecular weight of 272.34 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethanol;phenylmethoxymethylbenzene is sourced from PubChem (CID 87861777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).