C13H18O4 — CID 23452412
[4-(phenylmethoxymethyl)-1,3-dioxan-2-yl]methanol (PubChem CID 23452412) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is [4-(phenylmethoxymethyl)-1,3-dioxan-2-yl]methanol.
| Compound Name | [4-(phenylmethoxymethyl)-1,3-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 23452412 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [4-(phenylmethoxymethyl)-1,3-dioxan-2-yl]methanol |
| SMILES | OCC1OCCC(COCc2ccccc2)O1 |
| InChI | InChI=1S/C13H18O4/c14-8-13-16-7-6-12(17-13)10-15-9-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2 |
| InChIKey | XHOROTQWJPADGV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |