About oxolane;(2R)-2-(phenylmethoxymethyl)oxirane
oxolane;(2R)-2-(phenylmethoxymethyl)oxirane (PubChem CID 175076963) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is oxolane;(2R)-2-(phenylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | oxolane;(2R)-2-(phenylmethoxymethyl)oxirane |
| PubChem CID | 175076963 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | oxolane;(2R)-2-(phenylmethoxymethyl)oxirane |
| SMILES | C1CCOC1.c1ccc(COC[C@H]2CO2)cc1 |
| InChI | InChI=1S/C10H12O2.C4H8O/c1-2-4-9(5-3-1)6-11-7-10-8-12-10;1-2-4-5-3-1/h1-5,10H,6-8H2;1-4H2/t10-;/m0./s1 |
| InChIKey | ZZECIBBVOPQMPA-PPHPATTJSA-N |
| XLogP | 2.40 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxolane;(2R)-2-(phenylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;(2R)-2-(phenylmethoxymethyl)oxirane?
The IUPAC name of oxolane;(2R)-2-(phenylmethoxymethyl)oxirane (CID 175076963) is oxolane;(2R)-2-(phenylmethoxymethyl)oxirane.
What is the SMILES notation for oxolane;(2R)-2-(phenylmethoxymethyl)oxirane?
The canonical SMILES for oxolane;(2R)-2-(phenylmethoxymethyl)oxirane is C1CCOC1.c1ccc(COC[C@H]2CO2)cc1.
What is the InChIKey of oxolane;(2R)-2-(phenylmethoxymethyl)oxirane?
The InChIKey is ZZECIBBVOPQMPA-PPHPATTJSA-N. The full InChI is InChI=1S/C10H12O2.C4H8O/c1-2-4-9(5-3-1)6-11-7-10-8-12-10;1-2-4-5-3-1/h1-5,10H,6-8H2;1-4H2/t10-;/m0./s1.
What are the key properties of oxolane;(2R)-2-(phenylmethoxymethyl)oxirane?
oxolane;(2R)-2-(phenylmethoxymethyl)oxirane has a molecular weight of 236.31 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;(2R)-2-(phenylmethoxymethyl)oxirane is sourced from PubChem (CID 175076963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).