C60H64O12 — CID 101012741
2-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadecane (PubChem CID 101012741) has the molecular formula C60H64O12 and a molecular weight of 977.16 g/mol. Its IUPAC name is 2-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadecane.
| Compound Name | 2-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadecane |
|---|---|
| PubChem CID | 101012741 |
| Molecular Formula | C60H64O12 |
| Molecular Weight | 977.16 g/mol |
| Exact Mass | 976.44 |
| IUPAC Name | 2-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadecane |
| SMILES | c1ccc(COc2cc(COc3cc(COCC4COCCOCCOCCOCCO4)cc(OCc4cc(OCc5ccccc5)cc(OCc5ccccc5)c4)c3)cc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C60H64O12/c1-5-13-47(14-6-1)39-67-56-31-52(32-57(36-56)68-40-48-15-7-2-8-16-48)43-71-54-29-51(38-65-46-60-45-64-26-25-62-22-21-61-23-24-63-27-28-66-60)30-55(35-54)72-44-53-33-58(69-41-49-17-9-3-10-18-49)37-59(34-53)70-42-50-19-11-4-12-20-50/h1-20,29-37,60H,21-28,38-46H2 |
| InChIKey | ZYNOKIATCZAQQJ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.16 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |