C39H52O8 — CID 101174517
2-[[4-[[4-[4-(7-prop-2-enoxyheptoxy)phenyl]phenoxy]methyl]phenyl]methoxymethyl]-1,4,7,10-tetraoxacyclododecane (PubChem CID 101174517) has the molecular formula C39H52O8 and a molecular weight of 648.84 g/mol. Its IUPAC name is 2-[[4-[[4-[4-(7-prop-2-enoxyheptoxy)phenyl]phenoxy]methyl]phenyl]methoxymethyl]-1,4,7,10-tetraoxacyclododecane.
| Compound Name | 2-[[4-[[4-[4-(7-prop-2-enoxyheptoxy)phenyl]phenoxy]methyl]phenyl]methoxymethyl]-1,4,7,10-tetraoxacyclododecane |
|---|---|
| PubChem CID | 101174517 |
| Molecular Formula | C39H52O8 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | 2-[[4-[[4-[4-(7-prop-2-enoxyheptoxy)phenyl]phenoxy]methyl]phenyl]methoxymethyl]-1,4,7,10-tetraoxacyclododecane |
| SMILES | C=CCOCCCCCCCOc1ccc(-c2ccc(OCc3ccc(COCC4COCCOCCOCCO4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H52O8/c1-2-20-40-21-6-4-3-5-7-22-45-37-16-12-35(13-17-37)36-14-18-38(19-15-36)47-30-34-10-8-33(9-11-34)29-44-32-39-31-43-26-25-41-23-24-42-27-28-46-39/h2,8-19,39H,1,3-7,20-32H2 |
| InChIKey | RXHSVHZEZVTUIL-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|