C38H57FO10 — CID 146535716
1-[6-[2-fluoro-4-[4-[6-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)hexoxy]phenyl]phenoxy]hexoxy]prop-2-en-1-ol (PubChem CID 146535716) has the molecular formula C38H57FO10 and a molecular weight of 692.86 g/mol. Its IUPAC name is 1-[6-[2-fluoro-4-[4-[6-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)hexoxy]phenyl]phenoxy]hexoxy]prop-2-en-1-ol.
| Compound Name | 1-[6-[2-fluoro-4-[4-[6-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)hexoxy]phenyl]phenoxy]hexoxy]prop-2-en-1-ol |
|---|---|
| PubChem CID | 146535716 |
| Molecular Formula | C38H57FO10 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | 1-[6-[2-fluoro-4-[4-[6-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethoxy)hexoxy]phenyl]phenoxy]hexoxy]prop-2-en-1-ol |
| SMILES | C=CC(O)OCCCCCCOc1ccc(-c2ccc(OCCCCCCOCC3COCCOCCOCCOCCO3)cc2)cc1F |
| InChI | InChI=1S/C38H57FO10/c1-2-38(40)49-20-10-6-5-9-19-48-37-16-13-33(29-36(37)39)32-11-14-34(15-12-32)46-18-8-4-3-7-17-44-30-35-31-45-26-25-42-22-21-41-23-24-43-27-28-47-35/h2,11-16,29,35,38,40H,1,3-10,17-28,30-31H2 |
| InChIKey | QVKUMTJUHYXUJK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|