C36H51NO13 — CID 101262828
10-methyl-2,7-bis[2-(1,4,7,10-tetraoxacyclododec-2-ylmethoxy)ethoxy]acridin-9-one (PubChem CID 101262828) has the molecular formula C36H51NO13 and a molecular weight of 705.80 g/mol. Its IUPAC name is 10-methyl-2,7-bis[2-(1,4,7,10-tetraoxacyclododec-2-ylmethoxy)ethoxy]acridin-9-one.
| Compound Name | 10-methyl-2,7-bis[2-(1,4,7,10-tetraoxacyclododec-2-ylmethoxy)ethoxy]acridin-9-one |
|---|---|
| PubChem CID | 101262828 |
| Molecular Formula | C36H51NO13 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.34 |
| IUPAC Name | 10-methyl-2,7-bis[2-(1,4,7,10-tetraoxacyclododec-2-ylmethoxy)ethoxy]acridin-9-one |
| SMILES | Cn1c2ccc(OCCOCC3COCCOCCOCCO3)cc2c(=O)c2cc(OCCOCC3COCCOCCOCCO3)ccc21 |
| InChI | InChI=1S/C36H51NO13/c1-37-34-4-2-28(47-20-16-45-26-30-24-43-12-10-39-6-8-41-14-18-49-30)22-32(34)36(38)33-23-29(3-5-35(33)37)48-21-17-46-27-31-25-44-13-11-40-7-9-42-15-19-50-31/h2-5,22-23,30-31H,6-21,24-27H2,1H3 |
| InChIKey | YFQASETVFPCLDR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 132.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|