C22H29N3O3 — CID 57439698
2,7-bis[2-(ethylamino)ethoxy]-10-methylacridin-9-one (PubChem CID 57439698) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2,7-bis[2-(ethylamino)ethoxy]-10-methylacridin-9-one.
| Compound Name | 2,7-bis[2-(ethylamino)ethoxy]-10-methylacridin-9-one |
|---|---|
| PubChem CID | 57439698 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2,7-bis[2-(ethylamino)ethoxy]-10-methylacridin-9-one |
| SMILES | CCNCCOc1ccc2c(c1)c(=O)c1cc(OCCNCC)ccc1n2C |
| InChI | InChI=1S/C22H29N3O3/c1-4-23-10-12-27-16-6-8-20-18(14-16)22(26)19-15-17(28-13-11-24-5-2)7-9-21(19)25(20)3/h6-9,14-15,23-24H,4-5,10-13H2,1-3H3 |
| InChIKey | ROAFOSHBRLWYFJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|