C11H16N2O4 — CID 164856478
4-(1,4-dioxan-2-ylmethoxy)-1,6-dimethylpyrimidin-2-one (PubChem CID 164856478) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethoxy)-1,6-dimethylpyrimidin-2-one.
| Compound Name | 4-(1,4-dioxan-2-ylmethoxy)-1,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 164856478 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-(1,4-dioxan-2-ylmethoxy)-1,6-dimethylpyrimidin-2-one |
| SMILES | Cc1cc(OCC2COCCO2)nc(=O)n1C |
| InChI | InChI=1S/C11H16N2O4/c1-8-5-10(12-11(14)13(8)2)17-7-9-6-15-3-4-16-9/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | VWTWVJDSAIPTGQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |