C11H16N2O5S — CID 164856313
4-(1,4-dioxan-2-ylmethoxy)-6-methyl-2-methylsulfonylpyrimidine (PubChem CID 164856313) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethoxy)-6-methyl-2-methylsulfonylpyrimidine.
| Compound Name | 4-(1,4-dioxan-2-ylmethoxy)-6-methyl-2-methylsulfonylpyrimidine |
|---|---|
| PubChem CID | 164856313 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-(1,4-dioxan-2-ylmethoxy)-6-methyl-2-methylsulfonylpyrimidine |
| SMILES | Cc1cc(OCC2COCCO2)nc(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H16N2O5S/c1-8-5-10(13-11(12-8)19(2,14)15)18-7-9-6-16-3-4-17-9/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | DOMHSUBINSMPCF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |