C14H28O9S — CID 10714329
1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl methanesulfonate (PubChem CID 10714329) has the molecular formula C14H28O9S and a molecular weight of 372.44 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl methanesulfonate.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl methanesulfonate |
|---|---|
| PubChem CID | 10714329 |
| Molecular Formula | C14H28O9S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1COCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C14H28O9S/c1-24(15,16)23-13-14-12-21-9-8-19-5-4-17-2-3-18-6-7-20-10-11-22-14/h14H,2-13H2,1H3 |
| InChIKey | FVLNCPAQOZISSB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|